For research use only. Not for therapeutic Use.
Camalexin is an alkaloid released by plants of the <em>Brassicaceae</em> family in response to pathogen infection. In addition to antimicrobial properties and a role in plant defense, camalexin exhibits antiproliferative activity <em>in vitro</em> against various cancer cell lines. Camalexin is active against HeLa, Jurkat, MDA-MB-231, and CEM cancer cell lines (IC<sub>50</sub>s = 50.0, 46.2, 77.7, and 67.6 μM, respectively), but it is also toxic to primary human umbilical vein endothelial cells (HUVEC; (IC<sub>50</sub> = 74.0 μM). Camalexin induces apoptosis in Jurkat cells by increasing reactive oxygen species (ROS) levels and activating caspase-8 and caspase-9. In human prostate cancer cell lines, camalexin (25 μM) is more active against aggressive lines and increases ROS levels and apoptosis <em>via</em> cathepsin D relocation from lysosomes to the cytosol.
| Catalog Number | M130162 |
| CAS Number | 135531-86-1 |
| Synonyms | 3-(2-thiazolyl)-1H-indole |
| Molecular Formula | C11H8N2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 2-(1H-indol-3-yl)-1,3-thiazole |
| InChI | InChI=1S/C11H8N2S/c1-2-4-10-8(3-1)9(7-13-10)11-12-5-6-14-11/h1-7,13H |
| InChIKey | IYODIJVWGPRBGQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=NC=CS3 |
