For research use only, not for therapeutic use.
Cambinol (Cat No.:I011798) is a small molecule inhibitor of the NAD-dependent deacetylase enzymes known as sirtuins, specifically SIRT1 and SIRT2. Sirtuins are involved in a variety of biological processes including regulation of metabolism, aging, and stress response. Cambinol has been shown to inhibit SIRT1 and SIRT2 activity in vitro and in vivo, leading to an increase in acetylation levels of their target proteins. Cambinol has been studied for its potential therapeutic applications in various diseases, including cancer, neurodegenerative disorders, and metabolic disorders.
| Catalog Number | I011798 |
| CAS Number | 14513-15-6 |
| Synonyms | 2,3-dihydro-5-[(2-hydroxy-1-naphthalenyl)methyl]-6-phenyl-2-thioxo-4(1H)-pyrimidinone |
| Molecular Formula | C₂₁H₁₆N₂O₂S |
| Purity | ≥95% |
| Target | Sirtuin |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| InChI | InChI=1S/C21H16N2O2S/c24-18-11-10-13-6-4-5-9-15(13)16(18)12-17-19(14-7-2-1-3-8-14)22-21(26)23-20(17)25/h1-11,24H,12H2,(H2,22,23,25,26) |
| InChIKey | RVNSQVIUFZVNAU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C(=O)NC(=S)N2)CC3=C(C=CC4=CC=CC=C43)O |
