For research use only. Not for therapeutic Use.
Camfetamine Hydrochloride is a stimulant compound known for its psychoactive properties. It is primarily used in research to explore the effects of central nervous system stimulants. This compound is valuable in neuropharmacological studies due to its impact on dopamine and norepinephrine pathways. Camfetamine Hydrochloride’s high purity and consistent potency ensure reliable experimental results. Its applications extend to investigating potential therapeutic uses and understanding the mechanisms of stimulant-related behaviors, making it a crucial tool in advanced pharmacological research.
| Catalog Number | R032386 |
| CAS Number | 39628-11-0 |
| Synonyms | N-Methyl-3-phenyl-2-norbornanamine Hydrochloride;?N-Methyl-3-phenyl-Bicyclo[2.2.1]heptan-2-amine Hydrochloride;?N-Methyl-3-phenyl-2-norbornylamine Hydrochloride; |
| Molecular Formula | C14H20ClN |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | N-methyl-2-phenylbicyclo[2.2.1]heptan-3-amine;hydrochloride |
| InChI | InChI=1S/C14H19N.ClH/c1-15-14-12-8-7-11(9-12)13(14)10-5-3-2-4-6-10;/h2-6,11-15H,7-9H2,1H3;1H |
| InChIKey | SNBVPXDDYLRLIK-UHFFFAOYSA-N |
| SMILES | CNC1C2CCC(C2)C1C3=CC=CC=C3.Cl |
