For research use only. Not for therapeutic Use.
Campestanol（Cat No.:I023993） is a naturally occurring plant sterol that belongs to the group of phytosterols. It is commonly found in various plant sources, including vegetables, fruits, grains, and nuts. Campestanol shares structural similarities with cholesterol but is derived from plant sources instead of animals. It is known for its potential health benefits, such as its cholesterol-lowering properties and its role in maintaining cardiovascular health. Campestanol is often consumed as part of a balanced diet and is considered a valuable component of plant-based nutrition.
| Catalog Number | I023993 |
| CAS Number | 474-60-2 |
| Synonyms | Ergostanol; Campestanol |
| Molecular Formula | C28H50O |
| Purity | 98% |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | Store at -20°C |
| IUPAC Name | (3S,5S,8R,9S,10S,13R,14S,17R)-17-[(2R,5R)-5,6-dimethylheptan-2-yl]-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-ol |
| InChI | InChI=1S/C28H50O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h18-26,29H,7-17H2,1-6H3/t19-,20-,21+,22+,23+,24-,25+,26+,27+,28-/m1/s1 |
| InChIKey | ARYTXMNEANMLMU-ATEDBJNTSA-N |
| SMILES | O[C@H]1CC[C@]2(C)[C@@]3([H])CC[C@]4(C)[C@@H]([C@@H](CC[C@@H](C)C(C)C)C)CC[C@@]4([H])[C@]3([H])CC[C@@]2([H])C1 |
| Reference | 1: Connor WE, Lin DS, Pappu AS, Frohlich J, Gerhard G. Dietary sitostanol and campestanol: accumulation in the blood of humans with sitosterolemia and xanthomatosis and in rat tissues. Lipids. 2005 Sep;40(9):919-23. PubMed PMID: 16331855. |
