For research use only. Not for therapeutic Use.
Camphorquinone-10-sulfonic Acid Hydrate (Cat No.:C001141) is a chemical compound used in dental materials and restorative dentistry. It is a derivative of camphor quinone, serving as a photo-initiator in dental composites. The presence of the sulfonic acid group enhances its water solubility, making it suitable for aqueous-based dental formulations. When exposed to light, it initiates polymerization in dental composites, leading to the formation of hardened dental restorations.
| Catalog Number | C001141 |
| CAS Number | 355012-89-4 |
| Synonyms | 7,7-dimethyl-2,3-dioxobicyclo[2.2.1]heptane-1-methanesulfonic Acid; CQS-OH; |
| Molecular Formula | C₁₀H₁₆O₆S |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly) |
| Appearance | Yellow Solid |
| Storage | 4°C |
| IUPAC Name | [(1S,4S)-7,7-dimethyl-2,3-dioxo-1-bicyclo[2.2.1]heptanyl]methanesulfonic acid;hydrate |
| InChI | InChI=1S/C10H14O5S.H2O/c1-9(2)6-3-4-10(9,5-16(13,14)15)8(12)7(6)11;/h6H,3-5H2,1-2H3,(H,13,14,15);1H2/t6-,10-;/m1./s1 |
| InChIKey | YEGBEDZBQAKLIO-MIWKYWLESA-N |
| SMILES | CC1(C2CCC1(C(=O)C2=O)CS(=O)(=O)O)C.O |
| Reference | Wallace, C.J.A., et al.: Biochem. J., 215, 651 (1983), Dailey, H.A., et al.: J. Biol. Chem., 261, 7902 (1986), |
