For research use only. Not for therapeutic Use.
Cannabisin B（Cat No.:I043641）is a bioactive compound found in the cannabis plant, specifically in the Cannabis sativa species. It belongs to the class of flavonoids and has shown various pharmacological properties, including antioxidant, anti-inflammatory, and anticancer activities. Cannabisin B has been studied for its potential therapeutic effects in treating chronic pain, neurodegenerative diseases, and inflammatory conditions. Its ability to modulate key signaling pathways associated with inflammation and cell survival makes it a promising candidate for further research into the development of natural, plant-derived therapies for a range of health conditions.
| CAS Number | 144506-17-2 |
| Synonyms | (1S,2R)-1-(3,4-dihydroxyphenyl)-6,7-dihydroxy-2-N,3-N-bis[2-(4-hydroxyphenyl)ethyl]-1,2-dihydronaphthalene-2,3-dicarboxamide |
| Molecular Formula | C34H32N2O8 |
| Purity | ≥95% |
| IUPAC Name | (1S,2R)-1-(3,4-dihydroxyphenyl)-6,7-dihydroxy-2-N,3-N-bis[2-(4-hydroxyphenyl)ethyl]-1,2-dihydronaphthalene-2,3-dicarboxamide |
| InChI | InChI=1S/C34H32N2O8/c37-23-6-1-19(2-7-23)11-13-35-33(43)26-15-22-17-29(41)30(42)18-25(22)31(21-5-10-27(39)28(40)16-21)32(26)34(44)36-14-12-20-3-8-24(38)9-4-20/h1-10,15-18,31-32,37-42H,11-14H2,(H,35,43)(H,36,44)/t31-,32-/m0/s1 |
| InChIKey | XENYXHLAFMZULS-ACHIHNKUSA-N |
| SMILES | C1=CC(=CC=C1CCNC(=O)[C@@H]2[C@H](C3=CC(=C(C=C3C=C2C(=O)NCCC4=CC=C(C=C4)O)O)O)C5=CC(=C(C=C5)O)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
