For research use only. Not for therapeutic Use.
Cannabisin B (Compound 7) is a compound isolated from the aerial part of Tetragonia tetragonioides (New Zealand spinach)[1].
| Catalog Number | I043641 |
| CAS Number | 144506-17-2 |
| Synonyms | (1S,2R)-1-(3,4-dihydroxyphenyl)-6,7-dihydroxy-2-N,3-N-bis[2-(4-hydroxyphenyl)ethyl]-1,2-dihydronaphthalene-2,3-dicarboxamide |
| Molecular Formula | C34H32N2O8 |
| Purity | ≥95% |
| InChI | InChI=1S/C34H32N2O8/c37-23-6-1-19(2-7-23)11-13-35-33(43)26-15-22-17-29(41)30(42)18-25(22)31(21-5-10-27(39)28(40)16-21)32(26)34(44)36-14-12-20-3-8-24(38)9-4-20/h1-10,15-18,31-32,37-42H,11-14H2,(H,35,43)(H,36,44)/t31-,32-/m0/s1 |
| InChIKey | XENYXHLAFMZULS-ACHIHNKUSA-N |
| SMILES | C1=CC(=CC=C1CCNC(=O)C2C(C3=CC(=C(C=C3C=C2C(=O)NCCC4=CC=C(C=C4)O)O)O)C5=CC(=C(C=C5)O)O)O |
| Reference | [1]. Choi HS, et al. Phenolics, acyl galactopyranosyl glycerol, and lignan amides from Tetragonia tetragonioides (Pall.) Kuntze. Food Sci Biotechnol. 2016;25(5):1275-1281. |
