For research use only. Not for therapeutic Use.
Canocapavir（Cat No.:I043415）is an investigational antiviral compound being studied for its potential to inhibit the replication of HIV-1, the virus responsible for causing AIDS. It works by targeting and inhibiting the HIV-1 capsid, a protein structure that protects the virus’s genetic material and is essential for viral replication. By disrupting the capsid’s function, Canocapavir prevents the virus from successfully replicating within host cells. This mechanism makes it a promising candidate for use in HIV therapy, particularly for individuals with resistant strains or those seeking novel treatment options. Canocapavir is currently undergoing clinical trials for its safety and efficacy.
| CAS Number | 2137847-19-7 |
| Synonyms | (2R)-2-[1-(4-bromophenyl)-3-(4-fluorophenyl)pyrazol-4-yl]-3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]-1,3-oxazolidin-4-one |
| Molecular Formula | C27H21BrFN5O3 |
| Purity | ≥95% |
| IUPAC Name | (2R)-2-[1-(4-bromophenyl)-3-(4-fluorophenyl)pyrazol-4-yl]-3-[2-(2-oxo-1,3-dihydrobenzimidazol-5-yl)ethyl]-1,3-oxazolidin-4-one |
| InChI | InChI=1S/C27H21BrFN5O3/c28-18-4-8-20(9-5-18)34-14-21(25(32-34)17-2-6-19(29)7-3-17)26-33(24(35)15-37-26)12-11-16-1-10-22-23(13-16)31-27(36)30-22/h1-10,13-14,26H,11-12,15H2,(H2,30,31,36)/t26-/m1/s1 |
| InChIKey | YGPZZDKSASSELG-AREMUKBSSA-N |
| SMILES | C1C(=O)N([C@H](O1)C2=CN(N=C2C3=CC=C(C=C3)F)C4=CC=C(C=C4)Br)CCC5=CC6=C(C=C5)NC(=O)N6 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
