For research use only. Not for therapeutic Use.
Canrenone-D4（Cat No.:R074760） is a high-purity deuterated compound essential for advanced pharmaceutical research and drug development. Featuring four deuterium atoms, this isotopically labeled version of Canrenone is crucial for studying the pharmacokinetics, metabolism, and mechanism of action of mineralocorticoid receptor antagonists. Its precise isotope labeling ensures accurate and reliable analytical results, enhancing the quality of experimental data. Canrenone-D4 is widely used in research involving cardiovascular diseases, hormone regulation, and drug interaction studies.
| Catalog Number | R074760 |
| Synonyms | (1R,3aS,3bR,9aR,9bS,11aS)-9a,11a-dimethyl-2,3,3a,3b,7,8,9,9a,9b,10,11,11a-dodecahydrospiro[cyclopenta[a]phenanthrene-1,2′-oxolane]-5′,7-dione-d4 |
| Molecular Formula | C22H24D4O3 |
| Purity | 98% |
| Solubility | CHCl3, CH3CN |
| Appearance | Yellow Solid |
| Related CAS | 976-71-6(unlabeled) |
| Analysis method | atom D |
| IUPAC Name | (8R,9S,10R,13S,14S,17R)-2,2,3',3'-tetradeuterio-10,13-dimethylspiro[1,8,9,11,12,14,15,16-octahydrocyclopenta[a]phenanthrene-17,5'-oxolane]-2',3-dione |
| InChI | InChI=1S/C22H28O3/c1-20-9-5-15(23)13-14(20)3-4-16-17(20)6-10-21(2)18(16)7-11-22(21)12-8-19(24)25-22/h3-4,13,16-18H,5-12H2,1-2H3/t16-,17+,18+,20+,21+,22-/m1/s1/i5D2,8D2 |
| InChIKey | UJVLDDZCTMKXJK-WNDHVDQASA-N |
| SMILES | [2H]C1(C[C@@]2([C@H]3CC[C@]4([C@H]([C@@H]3C=CC2=CC1=O)CC[C@@]45CC(C(=O)O5)([2H])[2H])C)C)[2H] |
