For research use only. Not for therapeutic Use.
Caraphenol is a stilbenoid compound, structurally related to resveratrol, found in various plants, particularly in the skins of grapes and other berries. Like other stilbenoids, caraphenol exhibits antioxidant properties and has been studied for its potential health benefits, including anti-inflammatory, cardioprotective, and anticancer effects. It is of interest in the field of nutraceuticals and functional foods, where it is explored for its role in promoting health and preventing disease. Caraphenol’s ability to interact with biological pathways makes it a compound of interest in research on chronic diseases and aging.
| Catalog Number | R003103 |
| CAS Number | 354553-35-8 |
| Synonyms | (10R,11R,18S,19S)-3,11,19-tris(4-hydroxyphenyl)-4,12,20-trioxaheptacyclo[16.6.1.12,5.110,13.021,25.09,27.017,26]heptacosa-1(25),2,5,7,9(27),13,15,17(26),21,23-decaene-7,15,23-triol |
| Molecular Formula | C42H28O9 |
| Purity | ≥95% |
| InChI | InChI=1S/C42H28O9/c43-22-7-1-19(2-8-22)40-37-28-13-25(46)17-32-35(28)39(42(50-32)21-5-11-24(45)12-6-21)30-15-27(48)18-33-36(30)38(29-14-26(47)16-31(49-40)34(29)37)41(51-33)20-3-9-23(44)10-4-20/h1-18,37-38,40-41,43-48H/t37-,38+,40+,41-/m1/s1 |
| InChIKey | ULEJGXIKBFHUOY-PIQPXYRBSA-N |
| SMILES | C1=CC(=CC=C1C2C3C4=C5C(C(OC5=CC(=C4)O)C6=CC=C(C=C6)O)C7=C8C(=CC(=C7)O)OC(=C8C9=C3C(=CC(=C9)O)O2)C1=CC=C(C=C1)O)O |
