For research use only. Not for therapeutic Use.
Carazolol-d7（Cat No.:S001144） is a deuterated form of Carazolol, where seven hydrogen atoms are replaced with deuterium, enhancing its analytical stability. This isotopic modification is particularly valuable in pharmacological research for studying beta-blocker activity and metabolism. Carazolol-d7 is used in developing and validating analytical methods, ensuring accurate quantification in biological matrices. It plays a crucial role in understanding the pharmacokinetics and dynamics of Carazolol, aiding in the design of more effective cardiovascular treatments.
| Catalog Number | S001144 |
| CAS Number | 1173021-02-7 |
| Molecular Formula | C18H15D7N2O2 |
| Purity | ≥95% |
| IUPAC Name | 1-(9H-carbazol-4-yloxy)-3-(1,1,1,2,3,3,3-heptadeuteriopropan-2-ylamino)propan-2-ol |
| InChI | InChI=1S/C18H22N2O2/c1-12(2)19-10-13(21)11-22-17-9-5-8-16-18(17)14-6-3-4-7-15(14)20-16/h3-9,12-13,19-21H,10-11H2,1-2H3/i1D3,2D3,12D |
| InChIKey | BQXQGZPYHWWCEB-QLWPOVNFSA-N |
| SMILES | CC(C)NCC(COC1=CC=CC2=C1C3=CC=CC=C3N2)O |
