For research use only. Not for therapeutic Use.
Carbaryl (Cat.No:R054462) is a widely used insecticide and pesticide in agriculture and horticulture. It belongs to the carbamate chemical family and acts by inhibiting the activity of cholinesterase enzymes in insects, leading to their paralysis and death. Carbaryl is effective against various pests and offers crop protection while being relatively safe for humans and animals when used appropriately.
Catalog Number | R054462 |
CAS Number | 63-25-2 |
Synonyms | 1-Naphthyl N-Methylcarbamate; 1-Naphthalenol Methylcarbamate; 1-Naphtyl N-Methylcarbamate; ENT-23969; OMS-29; UC-7744; Carylderm; Derbac; Ravyon; Sevin; |
Molecular Formula | C12H11NO2 |
Purity | ≥95% |
Target | Parasite |
Storage | Store at RT |
IUPAC Name | naphthalen-1-yl N-methylcarbamate |
InChI | InChI=1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14) |
InChIKey | CVXBEEMKQHEXEN-UHFFFAOYSA-N |
SMILES | CNC(=O)OC1=CC=CC2=CC=CC=C21 |