For research use only. Not for therapeutic Use.
Carbazeran（Cat No.:R055269）is a selective, non-steroidal anti-inflammatory drug (NSAID) known for its ability to inhibit the enzyme cyclooxygenase (COX). By reducing COX activity, Carbazeran decreases the production of prostaglandins, which are involved in inflammation, pain, and fever. It is primarily used to manage conditions associated with inflammation, such as arthritis, osteoarthritis, and other musculoskeletal disorders. Carbazeran’s targeted action on COX-2 provides effective pain relief and reduces inflammation with a lower risk of gastrointestinal side effects compared to traditional NSAIDs. It is considered a valuable option in pain management therapy.
| CAS Number | 70724-25-3 |
| Synonyms | [1-(6,7-dimethoxyphthalazin-1-yl)piperidin-4-yl] N-ethylcarbamate |
| Molecular Formula | C18H24N4O4 |
| Purity | ≥95% |
| IUPAC Name | [1-(6,7-dimethoxyphthalazin-1-yl)piperidin-4-yl] N-ethylcarbamate |
| InChI | InChI=1S/C18H24N4O4/c1-4-19-18(23)26-13-5-7-22(8-6-13)17-14-10-16(25-3)15(24-2)9-12(14)11-20-21-17/h9-11,13H,4-8H2,1-3H3,(H,19,23) |
| InChIKey | QJGVXJYGDBSPSJ-UHFFFAOYSA-N |
| SMILES | CCNC(=O)OC1CCN(CC1)C2=NN=CC3=CC(=C(C=C32)OC)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
