For research use only. Not for therapeutic Use.
Carbazine (Cat.No:M002619) is a chemical compound known for its use in organic synthesis. It contains a hydrazine functional group and has applications in the production of pharmaceuticals, dyes, and agrochemicals. Additionally, it serves as a precursor in the synthesis of various heterocyclic compounds. Carbazine’s versatility makes it valuable in chemical research.
Catalog Number | M002619 |
CAS Number | 92-81-9 |
Synonyms | 9,10-dihydro-acridin;Acridane;CARBAZINE;ACRIDAN;9 10-DIHYDROACRIDINE;AI3-09022;ms-Dihydroacridine;Acridine, 9,10-dihydro- |
Molecular Formula | C13H11N |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 9,10-dihydroacridine |
InChI | InChI=1S/C13H11N/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)14-12/h1-8,14H,9H2 |
InChIKey | HJCUTNIGJHJGCF-UHFFFAOYSA-N |
SMILES | C1C2=CC=CC=C2NC3=CC=CC=C31 |
Reference | 1.Zinner G, Krause T, Dörschner K. [Cyclization reactions of semicarbazides and carbazine acid esters with aldehydes]. Arch Pharm (Weinheim). 1977 Aug;310(8):642-50. German. PubMed PMID: 921500.<br /> |