For research use only. Not for therapeutic Use.
Carbidopa-d3 monohydrate（Cat No.:S000341） is a deuterated form of carbidopa monohydrate, where three hydrogen atoms are replaced with deuterium. Carbidopa is used in combination with levodopa to treat Parkinson’s disease by inhibiting the enzyme that breaks down levodopa before it reaches the brain. The introduction of deuterium into carbidopa increases its molecular stability, allowing for enhanced pharmacokinetic and metabolic studies. This detailed analysis helps in understanding how carbidopa interacts and stabilizes the body, leading to improved therapeutic effects, optimized dosing, and a reduction in side effects associated with Parkinson’s treatment.
| Catalog Number | S000341 |
| CAS Number | 1276197-58-0 |
| Molecular Formula | C10H13D3N2O5 |
| Purity | ≥95% |
| IUPAC Name | (2S)-2-hydrazinyl-2-methyl-3-(2,3,6-trideuterio-4,5-dihydroxyphenyl)propanoic acid;hydrate |
| InChI | InChI=1S/C10H14N2O4.H2O/c1-10(12-11,9(15)16)5-6-2-3-7(13)8(14)4-6;/h2-4,12-14H,5,11H2,1H3,(H,15,16);1H2/t10-;/m0./s1/i2D,3D,4D; |
| InChIKey | QTAOMKOIBXZKND-INNGTCQHSA-N |
| SMILES | CC(CC1=CC(=C(C=C1)O)O)(C(=O)O)NN.O |
