For research use only. Not for therapeutic Use.
Carbonic acid phenyl(4-nitrophenyl) ester(Cat No.:M077127) is a chemical compound synthesized through the esterification of carbonic acid with 4-nitrophenol. It features a phenyl group attached to a carbonate functional group, with a nitro group positioned on the phenyl ring. This compound is utilized in organic synthesis as a versatile reagent for the introduction of carbonate functionalities into organic molecules. Additionally, it serves as a building block for the synthesis of various pharmaceuticals, agrochemicals, and functional materials.
CAS Number | 17175-11-0 |
Molecular Formula | C13H9NO5 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | (4-nitrophenyl) phenyl carbonate |
InChI | InChI=1S/C13H9NO5/c15-13(18-11-4-2-1-3-5-11)19-12-8-6-10(7-9-12)14(16)17/h1-9H |
InChIKey | IICMBPLBSCZBTN-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)OC(=O)OC2=CC=C(C=C2)[N+](=O)[O-] |