For research use only. Not for therapeutic Use.
Carbonic Acid tert-Butyl Phthalimido Ester(Cat No.:M081809)is a high-purity organic compound used primarily in pharmaceutical and chemical research. This molecule features a phthalimido group linked to a tert-butyl ester of carbonic acid, making it a valuable intermediate in the synthesis of complex organic molecules, including potential drug candidates. Its unique structure allows for selective reactivity, particularly in protecting group strategies during multi-step syntheses. Carbonic Acid tert-Butyl Phthalimido Ester is essential for precise synthetic applications, contributing to advancements in medicinal chemistry and innovative research efforts.
Catalog Number | M081809 |
CAS Number | 15263-20-4 |
Molecular Formula | C13H13NO5 |
Purity | ≥95% |
IUPAC Name | tert-butyl (1,3-dioxoisoindol-2-yl) carbonate |
InChI | InChI=1S/C13H13NO5/c1-13(2,3)18-12(17)19-14-10(15)8-6-4-5-7-9(8)11(14)16/h4-7H,1-3H3 |
InChIKey | MCWXBNWFVFOQAS-UHFFFAOYSA-N |
SMILES | CC(C)(C)OC(=O)ON1C(=O)C2=CC=CC=C2C1=O |