For research use only. Not for therapeutic Use.
(-)-Carbovir, also known as abacavir, is an antiviral medication used to treat HIV infection. It belongs to the nucleoside reverse transcriptase inhibitors (NRTIs) class, which works by inhibiting the replication of the virus. (-)-Carbovir is often used in combination with other antiretroviral drugs to enhance effectiveness and reduce resistance, playing a crucial role in HIV management and treatment.
CAS Number | 120443-30-3 |
Synonyms | (1R-cis)-2-Amino-1,9-dihydro-9-[4-(hydroxymethyl)-2-cyclopenten-1-yl]-6H-Purin-6-one; |
Molecular Formula | C11H13N5O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-amino-9-[(1R,4S)-4-(hydroxymethyl)cyclopent-2-en-1-yl]-3H-purin-6-one |
InChI | InChI=1S/C11H13N5O2/c12-11-14-9-8(10(18)15-11)13-5-16(9)7-2-1-6(3-7)4-17/h1-2,5-7,17H,3-4H2,(H3,12,14,15,18)/t6-,7+/m1/s1 |
InChIKey | XSSYCIGJYCVRRK-RQJHMYQMSA-N |
SMILES | C1C(C=CC1N2C=NC3=C2NC(=NC3=O)N)CO |