For research use only. Not for therapeutic Use.
Carboxin(Cat No.:R016876) is a synthetic fungicide belonging to the carboxamide class. Its action target involves inhibiting the respiratory chain in fungi, specifically the succinate dehydrogenase complex II (SDHI). The mode of action disrupts energy production in fungal cells, leading to their death and preventing the growth and spread of fungal diseases. Pharmacologically, Carboxin is utilized in agriculture to control various fungal pathogens in crops, including rusts, smuts, and bunts. It is particularly effective against diseases in cereals, such as wheat, barley, and oats.
| Catalog Number | R016876 |
| CAS Number | 5234-68-4 |
| Synonyms | 5,6-Dihydro-2-methyl-N-phenyl-1,4-oxathiin-3-carboxamide; 5,6-Dihydro-2-methyl-1,4-oxathiin-3-carboxanilide; 1-Oxa-2-methyl-3-(anilidocarbonyl)-4-thiacyclohex-2-ene; 2,3-Dihydro-5-carboxanilido-6-methyl-1,4-oxathiin; 2,3-Dihydro-6-methyl-1,4-oxathii |
| Molecular Formula | C12H13NO2S |
| Purity | ≥95% |
| Target | Fungal |
| Storage | Store at RT |
| IUPAC Name | 6-methyl-N-phenyl-2,3-dihydro-1,4-oxathiine-5-carboxamide |
| InChI | InChI=1S/C12H13NO2S/c1-9-11(16-8-7-15-9)12(14)13-10-5-3-2-4-6-10/h2-6H,7-8H2,1H3,(H,13,14) |
| InChIKey | GYSSRZJIHXQEHQ-UHFFFAOYSA-N |
| SMILES | CC1=C(SCCO1)C(=O)NC2=CC=CC=C2 |
| Reference | Wang, H., & Davis, R. M. (1997). Susceptibility of Selected Cotton Cultivars to Seedling Disease Pathogens and Benefits of Chemical Seed Treatments. <em>Plant Disease</em>, 81(9), 1085-1088. doi:10.1094/pdis.1997.81.9.1085</span></p> |
