For research use only. Not for therapeutic Use.
Carboxymethylmercaptosuccinic Acid(Cat No.:L007058), is a chemical compound derived from mercaptosuccinic acid. It is characterized by carboxymethyl (-CH2COOH) and mercapto (-SH) functional groups. This compound is used in various industrial applications, including chelating agents, metal complexing agents, and stabilizers for chemicals and cosmetics. Its chelating properties enable it to bind with metal ions, preventing undesired reactions and enhancing stability. Carboxymethylmercaptosuccinic acid is valuable in water treatment, textiles, and chemical processes where the sequestration of metal ions is essential.
CAS Number | 99-68-3 |
Molecular Formula | C6H8O6S |
Purity | ≥95% |
IUPAC Name | 2-(carboxymethylsulfanyl)butanedioic acid |
InChI | InChI=1S/C6H8O6S/c7-4(8)1-3(6(11)12)13-2-5(9)10/h3H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
InChIKey | JPHVSDWIWBDHOC-UHFFFAOYSA-N |
SMILES | C(C(C(=O)O)SCC(=O)O)C(=O)O |