For research use only. Not for therapeutic Use.
CARDAMONIN (Cat.No:M078534) is a natural chalcone compound found in plants like Alpinia katsumadai (cardamom). It exhibits diverse pharmacological activities, including anti-inflammatory, antioxidant, and anticancer effects. CARDAMONIN has been studied for its potential in modulating various signaling pathways and is of interest in drug development and complementary medicine research.
| CAS Number | 18956-16-6 |
| Molecular Formula | C16H14O4 |
| Purity | ≥95% |
| Target | Stem Cell/Wnt |
| Storage | -20°C |
| IUPAC Name | (E)-1-(2,4-dihydroxy-6-methoxyphenyl)-3-phenylprop-2-en-1-one |
| InChI | InChI=1S/C16H14O4/c1-20-15-10-12(17)9-14(19)16(15)13(18)8-7-11-5-3-2-4-6-11/h2-10,17,19H,1H3/b8-7+ |
| InChIKey | NYSZJNUIVUBQMM-BQYQJAHWSA-N |
| SMILES | COC1=CC(=CC(=C1C(=O)C=CC2=CC=CC=C2)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
