For research use only. Not for therapeutic Use.
CARM1-IN-3(CAT: I040934) is an inhibitor targeting coactivator-associated arginine methyltransferase 1 (CARM1), an enzyme involved in the regulation of gene expression through the methylation of arginine residues on histone and non-histone proteins. CARM1 plays a significant role in transcriptional regulation, cell differentiation, and cancer progression by modulating chromatin structure and gene activity. By inhibiting CARM1, CARM1-IN-3 can reverse aberrant gene expression patterns and potentially inhibit tumor cell proliferation. This compound is particularly relevant for Cancer Disease Research, offering a promising therapeutic strategy for cancers where CARM1 is overexpressed or dysregulated, such as in certain breast and prostate cancers.
| CAS Number | 912970-67-3 |
| Synonyms | 2-[4-[2-(2,6-dimethoxyphenyl)-7-methyl-3H-benzimidazol-5-yl]piperidin-1-yl]-N-methylethanamine |
| Molecular Formula | C24H32N4O2 |
| Purity | ≥95% |
| IUPAC Name | 2-[4-[2-(2,6-dimethoxyphenyl)-7-methyl-3H-benzimidazol-5-yl]piperidin-1-yl]-N-methylethanamine |
| InChI | InChI=1S/C24H32N4O2/c1-16-14-18(17-8-11-28(12-9-17)13-10-25-2)15-19-23(16)27-24(26-19)22-20(29-3)6-5-7-21(22)30-4/h5-7,14-15,17,25H,8-13H2,1-4H3,(H,26,27) |
| InChIKey | PFOQIHIIOLBCEQ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1N=C(N2)C3=C(C=CC=C3OC)OC)C4CCN(CC4)CCNC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
