For research use only. Not for therapeutic Use.
Carsalam (Cat No.:I002572) is a non-steroidal anti-inflammatory drug. 1,3-Benzoxazine-2,4(3H)-dione can be used as an intermediate in pharmaceutical and chemical synthesis and plays an important role. Such as the preparation of 8-(2-hydroxybenzamido) octanoic acid sodium.
| Catalog Number | I002572 |
| CAS Number | 2037-95-8 |
| Molecular Formula | C8H5NO3 |
| Purity | ≥95% |
| Solubility | DMSO:40mg/mL |
| Storage | Room Temperature |
| IUPAC Name | 1,3-benzoxazine-2,4-dione |
| InChI | InChI=1S/C8H5NO3/c10-7-5-3-1-2-4-6(5)12-8(11)9-7/h1-4H,(H,9,10,11) |
| InChIKey | OAYRYNVEFFWSHK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC(=O)O2 |
| Reference | <p style=/line-height:25px/> |
