For research use only. Not for therapeutic Use.
Cartap hydrochloride(Cat No.:M088093)is a widely used insecticide known for its effectiveness in controlling a broad range of agricultural pests. Derived from nereistoxin, this compound disrupts the nervous system of insects by blocking sodium channels, leading to paralysis and death. It is particularly effective against lepidopteran pests in crops like rice, sugarcane, and vegetables. Cartap hydrochloride is valued for its relatively low toxicity to mammals and beneficial insects, making it a preferred choice in integrated pest management (IPM) programs. Its stability and solubility enhance its application in various agricultural settings.
CAS Number | 15263-52-2 |
Molecular Formula | C7H16ClN3O2S2 |
Purity | ≥95% |
Target | NF-κB |
IUPAC Name | S-[3-carbamoylsulfanyl-2-(dimethylamino)propyl] carbamothioate;hydrochloride |
InChI | InChI=1S/C7H15N3O2S2.ClH/c1-10(2)5(3-13-6(8)11)4-14-7(9)12;/h5H,3-4H2,1-2H3,(H2,8,11)(H2,9,12);1H |
InChIKey | MSHXTAQSSIEBQS-UHFFFAOYSA-N |
SMILES | CN(C)C(CSC(=O)N)CSC(=O)N.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |