For research use only. Not for therapeutic Use.
Carvacrol(CAT: R022546) is a natural compound belonging to the class of monoterpenoids. Its mode of action involves being a phenolic compound found in the essential oils of various plants, including oregano, thyme, and savory. Carvacrol exhibits potential pharmacological properties, including antimicrobial, antioxidant, and anti-inflammatory effects. It has been used traditionally for its medicinal properties and is of interest in various industries, including food, cosmetics, and pharmaceuticals.
CAS Number | 499-75-2 |
Synonyms | 2-Methyl-5-(1-methylethyl)phenol; 2-Hydroxy-1-methyl-4-(1-methylethyl)benzene; 2-Hydroxy-p-cymene; 2-Methyl-5-(1-methylethyl)phenol; 2-Methyl-5-isopropylphenol; 3-Isopropyl-6-methylphenol; 5-Isopropyl-2-methylphenol; 5-Isopropyl-o-cresol; 6-Methyl-3- |
Molecular Formula | C10H14O |
Purity | ≥95% |
Target | Stem Cell/Wnt |
Storage | -20°C |
IUPAC Name | 2-methyl-5-propan-2-ylphenol |
InChI | InChI=1S/C10H14O/c1-7(2)9-5-4-8(3)10(11)6-9/h4-7,11H,1-3H3 |
InChIKey | RECUKUPTGUEGMW-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1)C(C)C)O |