For research use only. Not for therapeutic Use.
Casimiroin(CAT: I024142) is a natural compound isolated from the genus Casimiroa, known for its potential biological activities. As a flavonoid, it exhibits antioxidant, anti-inflammatory, and antimicrobial properties, making it valuable in pharmaceutical and natural product research. Casimiroin is particularly studied for its potential therapeutic applications in managing oxidative stress, inflammation-related disorders, and microbial infections. Its unique chemical structure and bioactivity profile provide insights into the development of novel therapeutic agents. Casimiroin is an essential tool for advancing research in drug discovery and understanding the pharmacological potential of plant-derived compounds.
CAS Number | 477-89-4 |
Synonyms | Casimiroin; UNII-1X2A1U6BH3 |
Molecular Formula | C12H11NO4 |
Purity | 98% |
Solubility | Soluble in DMSO |
Appearance | Solid powder |
Storage | Dry, dark and at 0 - 4 C for short term (days to weeks) or -20 C for long term (months to years). |
IUPAC Name | 1,3-Dioxolo(4,5-h)quinolin-8(9H)-one, 6-methoxy-9-methyl- |
InChI | InChI=1S/C12H11NO4/c1-13-10(14)5-9(15-2)7-3-4-8-12(11(7)13)17-6-16-8/h3-5H,6H2,1-2H3 |
InChIKey | DPXXJCMMMXZVSW-UHFFFAOYSA-N |
SMILES | O=C1N(C)C2=C(C=CC3=C2OCO3)C(OC)=C1 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |