For research use only. Not for therapeutic Use.
Castasterone is a bioactive brassinosteroid hormone found in plants that regulates growth and development processes. It plays a key role in promoting cell elongation, flowering, and stress responses by binding to specific brassinosteroid receptors and activating signal transduction pathways. Castasterone is involved in various physiological functions, including seed germination, vascular development, and defense mechanisms. Research on this compound explores its molecular mechanisms, interactions with other hormones, and potential applications in agriculture for improving crop yield and stress tolerance.
| Catalog Number | R051169 |
| CAS Number | 80736-41-0 |
| Synonyms | (2α,3α,5α,22R,23R,24S)-2,3,22,23-Tetrahydroxyergostan-6-one; BP 214; |
| Molecular Formula | C28H48O5 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | (2R,3S,5S,8S,9S,10R,13S,14S,17R)-17-[(2S,3R,4R,5S)-3,4-dihydroxy-5,6-dimethylheptan-2-yl]-2,3-dihydroxy-10,13-dimethyl-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one |
| InChI | InChI=1S/C28H48O5/c1-14(2)15(3)25(32)26(33)16(4)18-7-8-19-17-11-22(29)21-12-23(30)24(31)13-28(21,6)20(17)9-10-27(18,19)5/h14-21,23-26,30-33H,7-13H2,1-6H3/t15-,16-,17-,18+,19-,20-,21+,23-,24+,25+,26+,27+,28+/m0/s1 |
| InChIKey | VYUIKSFYFRVQLF-YLNAYWRASA-N |
| SMILES | CC(C)C(C)C(C(C(C)C1CCC2C1(CCC3C2CC(=O)C4C3(CC(C(C4)O)O)C)C)O)O |
