For research use only. Not for therapeutic Use.
Catechin(CAT: I001943) is a natural flavonoid widely used in antioxidant and cardiovascular research. Found abundantly in green tea, it exhibits potent antioxidant, anti-inflammatory, and anti-carcinogenic properties. Researchers utilize Catechin to explore its role in mitigating oxidative stress, improving endothelial function, and reducing the risk of chronic diseases such as atherosclerosis, cancer, and neurodegenerative disorders. Its bioactive potential also makes it valuable for studying metabolic regulation and immune modulation. With its versatility and safety, Catechin serves as a critical compound for preclinical and nutritional research aimed at promoting health and preventing disease.
CAS Number | 154-23-4 |
Molecular Formula | C15H14O6 |
Purity | ≥95% |
Target | Apoptosis |
Solubility | 50 mg/ml in DMSO |
Storage | store at -20℃ |
IUPAC Name | (2R,3S)-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2H-chromene-3,5,7-triol |
InChI | InChI=1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m0/s1 |
InChIKey | PFTAWBLQPZVEMU-DZGCQCFKSA-N |
SMILES | C1[C@@H]([C@H](OC2=CC(=CC(=C21)O)O)C3=CC(=C(C=C3)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |