For research use only. Not for therapeutic Use.
Catechol, also known as 1,2-dihydroxybenzene, is a naturally occurring organic compound belonging to the phenol family. It is a colorless, crystalline solid that is widely used in various chemical industries. Catechol serves as a building block in the synthesis of pharmaceuticals, agrochemicals, and dyes. It is also found in nature, being a key intermediate in the metabolism of plants and microorganisms. Additionally, Catechol has antioxidant properties and plays a role in the biosynthesis of important biological molecules like catecholamines, which are neurotransmitters involved in the regulation of physiological functions such as mood, cognition, and cardiovascular processes.
CAS Number | 120-80-9 |
Synonyms | 1,2-Benzenediol; Pyrocatechol; 1,2-Dihydroxybenzene; 2-Hydroxyphenol; Oxyphenic Acid; Phthalhydroquinone; Phthalic Alcohol; Pyrocatechin; o-Benzenediol; o-Dihydroxybenzene; o-Dioxybenzene; o-Hydroquinone; o-Hydroxyphenol; o-Phenylenediol; NSC 1573; |
Molecular Formula | C6H6O2 |
Purity | ≥95% |
Storage | Desiccate at -80C |
IUPAC Name | benzene-1,2-diol |
InChI | InChI=1S/C6H6O2/c7-5-3-1-2-4-6(5)8/h1-4,7-8H |
InChIKey | YCIMNLLNPGFGHC-UHFFFAOYSA-N |
SMILES | C1=CC=C(C(=C1)O)O |