For research use only. Not for therapeutic Use.
Cathepsin X-IN-1（Cat No.:I043674）is a potent and selective inhibitor of cathepsin X, a cysteine protease involved in various cellular processes, including immune regulation, inflammation, and tissue remodeling. By inhibiting cathepsin X activity, this compound can modulate immune cell functions and reduce inflammation, making it a promising therapeutic candidate for autoimmune diseases and chronic inflammatory conditions. Additionally, Cathepsin X-IN-1 may play a role in cancer therapy by disrupting tumor cell invasion and metastasis. Its targeted action suggests potential benefits in treating diseases driven by dysregulated protease activity.
| CAS Number | 2418577-51-0 |
| Synonyms | 2-[2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]sulfanylimidazol-1-yl]acetonitrile |
| Molecular Formula | C15H13N3O3S |
| Purity | ≥95% |
| IUPAC Name | 2-[2-[2-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-oxoethyl]sulfanylimidazol-1-yl]acetonitrile |
| InChI | InChI=1S/C15H13N3O3S/c16-3-5-18-6-4-17-15(18)22-10-12(19)11-1-2-13-14(9-11)21-8-7-20-13/h1-2,4,6,9H,5,7-8,10H2 |
| InChIKey | PTNGAXZNCFUKJN-UHFFFAOYSA-N |
| SMILES | C1COC2=C(O1)C=CC(=C2)C(=O)CSC3=NC=CN3CC#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
