For research use only. Not for therapeutic Use.
CAY10398 is an inhibitor of histone deacetylase (HDAC1) with an IC<sub>50</sub> value of 10 µM. Similar potency is observed with trapoxin A and B, whereas trichostatin A is more potent inhibitor of the enzyme. Trichostatin A also selectively inhibits the removal of acetyl groups from the amino-<wbr></wbr>terminal lysine residues of core histones, which modulates the access of transcription factors to the underlying genomic DNA. However, trichostatin A is much more expensive than CAY10398. CAY10398 thus represents a selective and cost-<wbr></wbr>effective compound for the inhibition of HDAC.
| Catalog Number | R067381 |
| CAS Number | 193551-00-7 |
| Synonyms | MD 85;PX 089274 |
| Molecular Formula | C15H23N3O3 |
| Purity | ≥95% |
| Target | Epigenetics |
| Storage | -20°C |
| IUPAC Name | 4-(dimethylamino)-N-[6-(hydroxyamino)-6-oxohexyl]benzamide |
| InChI | InChI=1S/C15H23N3O3/c1-18(2)13-9-7-12(8-10-13)15(20)16-11-5-3-4-6-14(19)17-21/h7-10,21H,3-6,11H2,1-2H3,(H,16,20)(H,17,19) |
| InChIKey | RGWSSTALGUXZMU-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC=C(C=C1)C(=O)NCCCCCC(=O)NO |
| Reference | 1.Jung, M.,Hoffmann, K.,Brosch, G., et al. Analogues of Trichostatin A and Trapoxin B as histone deacetylase inhibitors. Bioorganic & Medicinal Chemistry Letters 7, 1655-1658 (1997). |
