For research use only. Not for therapeutic Use.
CAY10574（Cat No.:R040419）is a selective inhibitor of the Wnt/β-catenin signaling pathway, which plays a critical role in cell proliferation, differentiation, and survival. By inhibiting β-catenin-mediated transcription, CAY10574 disrupts the abnormal activation of Wnt signaling often associated with various cancers. This compound is valuable for research focused on targeting Wnt-driven cancers, including colorectal, breast, and hepatocellular carcinomas. Its ability to block this pathway offers potential therapeutic applications in cancer treatment and regenerative medicine, where modulation of Wnt signaling can influence tissue repair and stem cell function.
| Catalog Number | R040419 |
| CAS Number | 140651-18-9 |
| Synonyms | 4-[(3,5-diamino-1H-pyrazol-4-yl)azo]-phenol |
| Molecular Formula | C9H10N6O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-[(3,5-diamino-1H-pyrazol-4-yl)hydrazinylidene]cyclohexa-2,5-dien-1-one |
| InChI | InChI=1S/C9H10N6O/c10-8-7(9(11)15-14-8)13-12-5-1-3-6(16)4-2-5/h1-4,13H,(H5,10,11,14,15) |
| InChIKey | FHZNRKGCGRGLFC-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)C=CC1=NNC2=C(NN=C2N)N |
| Reference | 1.Krystof, V.,Cankar, P.,Frysová, I., et al. 4-Arylazo-3,5-diamino-1H-pyrazole CDK inhibitors: SAR study, crystal structure in complex with CDK2, selectivity, and cellular effects. Journal of Medicinal Chemistry 49, 6500-6509 (2006). |
