For research use only. Not for therapeutic Use.
CAY10602（Cat No.:R028651）is a potent and selective inhibitor of histone deacetylase 6 (HDAC6), an enzyme involved in the regulation of protein degradation, cell motility, and immune responses. By inhibiting HDAC6, CAY10602 promotes the accumulation of acetylated tubulin, leading to disrupted protein homeostasis and inducing apoptosis, particularly in cancer cells. This compound is valuable in cancer research for its ability to enhance the efficacy of immunotherapies and other anticancer agents. CAY10602 is widely used to study the role of HDAC6 in cancer progression, neurodegenerative diseases, and immune regulation.
| Catalog Number | R028651 |
| CAS Number | 374922-43-7 |
| Synonyms | 1-(4-fluorophenyl)-3-(phenylsulfonyl)-1H-pyrrolo[2,3-b]quinoxalin-2-amine |
| Molecular Formula | C22H15FN4O2S |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-(benzenesulfonyl)-1-(4-fluorophenyl)pyrrolo[3,2-b]quinoxalin-2-amine |
| InChI | InChI=1S/C22H15FN4O2S/c23-14-10-12-15(13-11-14)27-21(24)20(30(28,29)16-6-2-1-3-7-16)19-22(27)26-18-9-5-4-8-17(18)25-19/h1-13H,24H2 |
| InChIKey | CSFVFDHRYKBBPD-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=O)(=O)C2=C(N(C3=NC4=CC=CC=C4N=C23)C5=CC=C(C=C5)F)N |
| Reference | 1.Nayagam, V.M.,Wang, X.,Tan, Y.C., et al. SIRT1 modulating compounds from high-throughput screening as anti-inflammatory and insulin-sensitizing agents. Journal of Biomolecular Screening 11(8), 959-967 (2006). |
