For research use only. Not for therapeutic Use.
CB-1158 (CAT: I001296) is a potent and selective inhibitor of the enzyme arginase 1 (ARG1), which plays a crucial role in immune suppression and tumor growth in the tumor microenvironment. By inhibiting ARG1, CB-1158 promotes the accumulation of arginine, an essential amino acid for T cell function, leading to enhanced anti-tumor immune responses. CB-1158 has demonstrated efficacy in preclinical studies, showing the ability to inhibit tumor growth and enhance the anti-tumor immune response. It holds promise as a potential immunotherapy agent for the treatment of various cancers and is currently being investigated in clinical trials.
| Catalog Number | I001296 |
| CAS Number | 2095732-06-0 |
| Molecular Formula | C11H22BN3O5 |
| Purity | ≥95% |
| IUPAC Name | (3R,4S)-3-amino-1-[(2S)-2-aminopropanoyl]-4-(3-boronopropyl)pyrrolidine-3-carboxylic acid |
| InChI | InChI=1S/C11H22BN3O5/c1-7(13)9(16)15-5-8(3-2-4-12(19)20)11(14,6-15)10(17)18/h7-8,19-20H,2-6,13-14H2,1H3,(H,17,18)/t7-,8-,11-/m0/s1 |
| InChIKey | ZZJLMZYUGLJBSO-LAEOZQHASA-N |
| SMILES | B(CCCC1CN(CC1(C(=O)O)N)C(=O)C(C)N)(O)O |
