For research use only. Not for therapeutic Use.
CB-1158 is a potent arginase inhibitor. CB-1158 has the potential for anti-tumor activity in renal cell cancer, breast cancer, non-small cell lung cancer, acute myeloid leukemia, and other tumor types where arginase-secreting MDSCs are known to play an im
| Catalog Number | I005706 |
| CAS Number | 1345810-21-0 |
| Synonyms | CB-1158; CB 1158; CB1158.;2-amino-6-borono-2-(1-(2,4-dichlorobenzyl)piperidin-4-yl)hexanoic acid |
| Molecular Formula | C18H27BCl2N2O4 |
| Purity | ≥95% |
| Target | arginase inhibitor |
| Solubility | Soluble in DMSO |
| Storage | 0 - 4°C for short term ,or -20 °C for long term |
| InChI | InChI=1S/C18H27BCl2N2O4/c20-15-4-3-13(16(21)11-15)12-23-9-5-14(6-10-23)18(22,17(24)25)7-1-2-8-19(26)27/h3-4,11,14,26-27H,1-2,5-10,12,22H2,(H,24,25) |
| InChIKey | ISYBHIALKUAHGV-UHFFFAOYSA-N |
| SMILES | ClC1=CC(Cl)=CC=C1CN2CCC(C(N)(CCCCB(O)O)C(O)=O)CC2 |
