For research use only. Not for therapeutic Use.
CB1/2 Agonist 3(Cat No.:I043352)is a selective compound that activates both the CB1 and CB2 receptors of the endocannabinoid system. These receptors are involved in regulating various physiological functions, including mood, appetite, pain perception, and immune response. By targeting both CB1 and CB2 receptors, CB1/2 Agonist 3 has the potential to modulate these pathways, offering therapeutic benefits in conditions such as chronic pain, inflammation, and neurodegenerative diseases. Its dual receptor activation makes it an attractive candidate for research into novel treatments with fewer side effects compared to traditional cannabinoid therapies.
CAS Number | 2772655-86-2 |
Synonyms | N-cyclopropyl-11-(3-pentylphenoxy)undecanamide |
Molecular Formula | C25H41NO2 |
Purity | ≥95% |
IUPAC Name | N-cyclopropyl-11-(3-pentylphenoxy)undecanamide |
InChI | InChI=1S/C25H41NO2/c1-2-3-10-14-22-15-13-16-24(21-22)28-20-12-9-7-5-4-6-8-11-17-25(27)26-23-18-19-23/h13,15-16,21,23H,2-12,14,17-20H2,1H3,(H,26,27) |
InChIKey | ZWANZUMSTXYAJD-UHFFFAOYSA-N |
SMILES | CCCCCC1=CC(=CC=C1)OCCCCCCCCCCC(=O)NC2CC2 |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |