For research use only. Not for therapeutic Use.
CB-7921220 is a compound that acts as an inhibitor of adenylate cyclase. Adenylate cyclase is an enzyme that converts ATP to cyclic AMP (cAMP), an important second messenger molecule in many biological processes. By inhibiting adenylate cyclase, CB-7921220 reduces the production of cAMP, potentially leading to downstream effects in cellular signaling pathways.
| CAS Number | 115453-99-1 |
| Synonyms | CB7921220;6-[2-(4-Aminophenyl)vinyl]-2-pyridinecarboxylic acid |
| Molecular Formula | C14H12N2O2 |
| Purity | ≥95% |
| Target | Adenylate Cyclase |
| Solubility | Soluble in DMSO |
| Storage | -20°C |
| IUPAC Name | 6-[(E)-2-(4-aminophenyl)ethenyl]pyridine-2-carboxylic acid |
| InChI | InChI=1S/C14H12N2O2/c15-11-7-4-10(5-8-11)6-9-12-2-1-3-13(16-12)14(17)18/h1-9H,15H2,(H,17,18)/b9-6+ |
| InChIKey | QASPDWZDKLUOPO-RMKNXTFCSA-N |
| SMILES | C1=CC(=NC(=C1)C(=O)O)C=CC2=CC=C(C=C2)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
