For research use only. Not for therapeutic Use.
Cbl-b-IN-2（Cat No.:I043456）is a selective inhibitor of Cbl-b, an E3 ubiquitin ligase that plays a critical role in regulating immune cell signaling. Cbl-b negatively regulates T-cell activation, and its inhibition can enhance immune responses, making it a potential therapeutic agent in cancer immunotherapy. By blocking Cbl-b activity, Cbl-b-IN-2 may promote the activation of T-cells and other immune cells, thereby enhancing the body’s ability to fight tumors or infections. Cbl-b-IN-2 is being investigated for its potential to improve anti-tumor immunity and as a treatment for diseases where immune suppression is a factor.
| CAS Number | 2503325-21-9 |
| Synonyms | 6-[[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methyl]-2-[3-[3-[(4-methyl-1,2,4-triazol-3-yl)methyl]oxetan-3-yl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one |
| Molecular Formula | C29H30F5N5O2 |
| Purity | ≥95% |
| IUPAC Name | 6-[[(3R)-4,4-difluoro-3-methylpiperidin-1-yl]methyl]-2-[3-[3-[(4-methyl-1,2,4-triazol-3-yl)methyl]oxetan-3-yl]phenyl]-4-(trifluoromethyl)-3H-isoindol-1-one |
| InChI | InChI=1S/C29H30F5N5O2/c1-18-12-38(7-6-28(18,30)31)13-19-8-22-23(24(9-19)29(32,33)34)14-39(26(22)40)21-5-3-4-20(10-21)27(15-41-16-27)11-25-36-35-17-37(25)2/h3-5,8-10,17-18H,6-7,11-16H2,1-2H3/t18-/m1/s1 |
| InChIKey | YQALLLNHBDHXFZ-GOSISDBHSA-N |
| SMILES | C[C@@H]1CN(CCC1(F)F)CC2=CC3=C(CN(C3=O)C4=CC=CC(=C4)C5(COC5)CC6=NN=CN6C)C(=C2)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
