For research use only. Not for therapeutic Use.
Cbl-b-IN-5 (CAT: I040888) is a potent inhibitor of Cbl-b with an IC50 range of 3-10 µM. Cbl-b-IN-5 has the potential to enhance immune system modulation, making it a promising tool for cancer research and related diseases. By inhibiting Cbl-b, a negative regulator of immune responses, this compound could be leveraged to improve immune system activity, which may have therapeutic implications in cancers that involve immune evasion or dysfunction.
| CAS Number | 2368835-59-8 |
| Synonyms | N-[3-[1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]phenyl]pyridine-2-carboxamide |
| Molecular Formula | C17H17N5OS |
| Purity | ≥95% |
| IUPAC Name | N-[3-[1-[(4-methyl-1,2,4-triazol-3-yl)sulfanyl]ethyl]phenyl]pyridine-2-carboxamide |
| InChI | InChI=1S/C17H17N5OS/c1-12(24-17-21-19-11-22(17)2)13-6-5-7-14(10-13)20-16(23)15-8-3-4-9-18-15/h3-12H,1-2H3,(H,20,23) |
| InChIKey | BOVJKQTZTZBOBN-UHFFFAOYSA-N |
| SMILES | CC(C1=CC(=CC=C1)NC(=O)C2=CC=CC=N2)SC3=NN=CN3C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
