For research use only. Not for therapeutic Use.
CBL0137 hydrochloride(CAT: I011714) is a small molecule inhibitor that targets the heat shock protein 70 (HSP70) pathway. It disrupts the interaction between HSP70 and its client proteins, which are crucial for maintaining cellular protein homeostasis. By inhibiting this pathway, CBL0137 induces cancer cell death, particularly in tumor cells with high levels of protein misfolding or stress. It has demonstrated promising anticancer activity in preclinical studies and is being evaluated for its potential in treating various solid tumors and hematologic cancers.
| CAS Number | 1197397-89-9 |
| Synonyms | 1,1′-[9-[2-[(1-methylethyl)imino]ethyl]-9H-carbazole-3,6-diyl]<em>bis</em>-ethanone, monohydrochloride |
| Molecular Formula | C21H24N2O2 • HCl |
| Purity | ≥95% |
| Target | NF-κB |
| Solubility | Soluble in DMSO |
| Storage | Store at -20°C |
| IUPAC Name | 1-[6-acetyl-9-[2-(propan-2-ylamino)ethyl]carbazol-3-yl]ethanone;hydrochloride |
| InChI | 1S/C21H24N2O2.ClH/c1-13(2)22-9-10-23-20-7-5-16(14(3)24)11-18(20)19-12-17(15(4)25)6-8-21(19)23;/h5-8,11-13,22H,9-10H2,1-4H3;1H |
| InChIKey | IXRKBBVMDMKAEB-UHFFFAOYSA-N |
| SMILES | CC(C)NCCN1C2=C(C=C(C=C2)C(=O)C)C3=C1C=CC(=C3)C(=O)C.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
