For research use only. Not for therapeutic Use.
CBS1117（Cat No.:I015514）is a synthetic compound known for its potential biological activity, particularly in research focused on cancer and inflammation. It is being investigated for its inhibitory effects on specific cellular pathways involved in tumor growth and immune response regulation. CBS1117’s mechanism of action includes modulation of signaling pathways that are critical for cell proliferation, survival, and inflammation, making it a valuable tool in experimental oncology and immunology studies. Its unique properties support ongoing research efforts to better understand its efficacy and possible applications in therapeutic development.
| Catalog Number | I015514 |
| CAS Number | 959245-08-0 |
| Molecular Formula | C₁₅H₂₀Cl₂N₂O |
| Purity | ≥95% |
| Target | Influenza Virus |
| Storage | Store at -20°C |
| IUPAC Name | 2,6-dichloro-N-(1-propan-2-ylpiperidin-4-yl)benzamide |
| InChI | InChI=1S/C15H20Cl2N2O/c1-10(2)19-8-6-11(7-9-19)18-15(20)14-12(16)4-3-5-13(14)17/h3-5,10-11H,6-9H2,1-2H3,(H,18,20) |
| InChIKey | OUZZSIOQTSNTTI-UHFFFAOYSA-N |
| SMILES | CC(C)N1CCC(CC1)NC(=O)C2=C(C=CC=C2Cl)Cl |
| Reference | [1]. Hussein AFA, et al. Identification of entry inhibitors with 4-aminopiperidine scaffold targeting group 1 influenza A virus. Antiviral Res. 2020 May;177:104782. |
