Cbz-4-tert-butyl-D-phenylalanine（Cat No.:L007156）, is a chiral chemical compound significant in medicinal chemistry and peptide research. It is a derivative of D-phenylalanine with a carboxybenzyl (Cbz) protecting group at the amino group and a tert-butyl group at the 4th position of the phenylalanine side chain. This compound is often used in the synthesis of peptides, including those with therapeutic applications. Its chiral and protected nature enables precise peptide construction, contributing to the development of bioactive molecules and drug candidates. Researchers utilize Cbz-4-tert-butyl-D-phenylalanine for peptide design, advancing pharmaceuticals and peptide-based therapies.
| Catalog Number | L007156 |
| CAS Number | 1270290-73-7 |
| Molecular Formula | C21H25NO4 |
| Purity | ≥95% |
| IUPAC Name | (2R)-3-(4-tert-butylphenyl)-2-(phenylmethoxycarbonylamino)propanoic acid |
| InChI | InChI=1S/C21H25NO4/c1-21(2,3)17-11-9-15(10-12-17)13-18(19(23)24)22-20(25)26-14-16-7-5-4-6-8-16/h4-12,18H,13-14H2,1-3H3,(H,22,25)(H,23,24)/t18-/m1/s1 |
| InChIKey | XBNNNROLVWMWES-GOSISDBHSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)CC(C(=O)O)NC(=O)OCC2=CC=CC=C2 |
