For research use only. Not for therapeutic Use.
Cbz-L-alaninol, also known as carbobenzyloxy-L-alaninol, is an amino alcohol derived from L-alanine, featuring a carbobenzyloxy (Cbz) protecting group. This compound is characterized by its amino group and hydroxyl group, which provide reactivity for further chemical modifications. The Cbz protecting group is commonly used in peptide synthesis to enhance stability and control reactivity. Cbz-L-alaninol serves as an important intermediate in the synthesis of various bioactive compounds and pharmaceuticals, making it valuable in organic and medicinal chemistry.
CAS Number | 66674-16-6 |
Molecular Formula | C11H15NO3 |
Purity | ≥95% |
IUPAC Name | benzyl N-[(2S)-1-hydroxypropan-2-yl]carbamate |
InChI | InChI=1S/C11H15NO3/c1-9(7-13)12-11(14)15-8-10-5-3-2-4-6-10/h2-6,9,13H,7-8H2,1H3,(H,12,14)/t9-/m0/s1 |
InChIKey | AFPHMHSLDRPUSM-VIFPVBQESA-N |
SMILES | C[C@@H](CO)NC(=O)OCC1=CC=CC=C1 |