For research use only. Not for therapeutic Use.
CbzNH-PEG3-CH2CH2NH2 (Cat No.:L010080) is a chemical compound used in organic synthesis, featuring a benzyloxycarbonyl (Cbz) protecting group attached to an amino group (NH) through a polyethylene glycol (PEG) spacer with three ethylene glycol units. The PEG spacer provides water solubility and enhances biocompatibility. This compound serves as a protecting group strategy to temporarily shield the amine functionality during chemical transformations. It has potential applications in pharmaceutical research and drug development, where the PEG component aids in enhancing the compound’s properties for various biological applications.
CAS Number | 863973-20-0 |
Molecular Formula | C16H26N2O5 |
Purity | ≥95% |
IUPAC Name | benzyl N-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethyl]carbamate |
InChI | InChI=1S/C16H26N2O5/c17-6-8-20-10-12-22-13-11-21-9-7-18-16(19)23-14-15-4-2-1-3-5-15/h1-5H,6-14,17H2,(H,18,19) |
InChIKey | JKGORDLYOYIQQV-UHFFFAOYSA-N |
SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCN |