For research use only. Not for therapeutic Use.
CC-11050（Cat No.:I024223） is a bioactive chemical compound that exhibits biological activity or functionality. However, without additional specific information about CC-11050, it is challenging to provide a comprehensive description. Bioactive chemicals can have diverse effects, such as modulating enzyme activity, influencing cellular processes, or interacting with biological targets.
| Catalog Number | I024223 |
| CAS Number | 340019-69-4 |
| Synonyms | CC-11050; CC 11050; CC11050 |
| Molecular Formula | C24H28N2O6S |
| Purity | 98% |
| Target | Phosphodiesterase (PDE) |
| Solubility | Soluble in DMSO |
| Appearance | Solid powder |
| Storage | 4°C, away from moisture and light |
| IUPAC Name | Cyclopropanecarboxamide, N-(2-((1S)-1-(3-ethoxy-4-methoxyphenyl)-2-(methylsulfonyl)ethyl)-2,3-dihydro-3-oxo-1H-isoindol-4-yl)- |
| InChI | InChI=1S/C24H28N2O6S/c1-4-32-21-12-16(10-11-20(21)31-2)19(14-33(3,29)30)26-13-17-6-5-7-18(22(17)24(26)28)25-23(27)15-8-9-15/h5-7,10-12,15,19H,4,8-9,13-14H2,1-3H3,(H,25,27)/t19-/m1/s1 |
| InChIKey | QDZOBXFRIVOQBR-LJQANCHMSA-N |
| SMILES | O=C(C1CC1)NC2=CC=CC(CN3[C@@H](C4=CC=C(OC)C(OCC)=C4)CS(=O)(C)=O)=C2C3=O |
| Reference | 1: Boulougoura A, Gabriel E, Laidlaw E, Khetani V, Arakawa K, Higgins J, Rupert A, Gorelick RJ, Lumbard K, Pau A, Poole A, Kibiy A, Kumar P, Sereti I. A Phase I, Randomized, Controlled Clinical Study of CC-11050 in People Living With HIV With Suppressed Plasma Viremia on Antiretroviral Therapy (APHRODITE). Open Forum Infect Dis. 2019 Jun 3;6(6):ofz246. doi: 10.1093/ofid/ofz246. PMID: 31211164; PMCID: PMC6559277. |
