For research use only. Not for therapeutic Use.
CC-122(Cat No.:I000128)is a potent immunomodulatory compound with anticancer properties, belonging to the class of cereblon (CRBN) modulators. It functions by binding to CRBN, a key component of the E3 ubiquitin ligase complex, leading to targeted degradation of transcription factors essential for cancer cell survival. This action promotes apoptosis and inhibits tumor growth, making CC-122 valuable in treating hematologic malignancies and certain solid tumors. Additionally, it exhibits immune-enhancing effects, such as stimulating T-cells and natural killer cells, positioning it as a promising candidate in cancer immunotherapy research and development.
Catalog Number | I000128 |
CAS Number | 1015474-32-4 |
Molecular Formula | C₁₄H₁₄N₄O₃ |
Purity | ≥95% |
Target | pleiotropic pathway modulator |
Solubility | DMSO ≥ 33 mg/mL |
Storage | -20°C |
IUPAC Name | 3-(5-amino-2-methyl-4-oxoquinazolin-3-yl)piperidine-2,6-dione |
InChI | InChI=1S/C14H14N4O3/c1-7-16-9-4-2-3-8(15)12(9)14(21)18(7)10-5-6-11(19)17-13(10)20/h2-4,10H,5-6,15H2,1H3,(H,17,19,20) |
InChIKey | RSNPAKAFCAAMBH-UHFFFAOYSA-N |
SMILES | CC1=NC2=CC=CC(=C2C(=O)N1C3CCC(=O)NC3=O)N |
Reference | <p style=/line-height:25px/> </p> |