For research use only. Not for therapeutic Use.
CC-17369 (7-Hydroxy pomalidomide)(CAT: I004908) is a metabolite of pomalidomide and serves as a cereblon (CRBN) ligand in the context of PROTAC (Proteolysis Targeting Chimera) technology. As a CRBN ligand, CC-17369 is crucial for recruiting the CRBN E3 ubiquitin ligase, which tags target proteins for degradation. By connecting CC-17369 to a ligand for a specific protein through a linker, researchers can develop PROTACs that induce the degradation of disease-related proteins, such as those involved in cancer and neurodegenerative disorders. This compound is instrumental in advancing targeted protein degradation therapies, offering a novel approach to drug discovery and therapeutic intervention.
| Catalog Number | I004908 |
| CAS Number | 1547162-46-8 |
| Synonyms | 4-amino-2-(2,6-dioxopiperidin-3-yl)-7-hydroxyisoindole-1,3-dione |
| Molecular Formula | C13H11N3O5 |
| Purity | ≥95% |
| InChI | InChI=1S/C13H11N3O5/c14-5-1-3-7(17)10-9(5)12(20)16(13(10)21)6-2-4-8(18)15-11(6)19/h1,3,6,17H,2,4,14H2,(H,15,18,19) |
| InChIKey | DNODJHQYSZVNMH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2C(=O)C3=C(C=CC(=C3C2=O)O)N |
