For research use only. Not for therapeutic Use.
CCG273441（Cat No.:I043098）is a small molecule inhibitor under investigation for its potential therapeutic applications in cancer treatment. It functions by targeting specific signaling pathways that are crucial for tumor cell proliferation and survival. CCG273441 is known to interfere with kinases and other molecular targets involved in the regulation of cell growth, apoptosis, and metastasis. This compound has shown promise in preclinical studies for its ability to inhibit the growth of various cancer cell lines. Research is ongoing to determine its efficacy, safety, and potential use as a targeted therapy in oncology.
| CAS Number | 2750414-35-6 |
| Synonyms | (3Z)-3-[[4-[(2-chloroacetyl)amino]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-N-[(1R)-1-(4-fluorophenyl)ethyl]-2-oxo-1H-indole-5-carboxamide |
| Molecular Formula | C26H24ClFN4O3 |
| Purity | ≥95% |
| IUPAC Name | (3Z)-3-[[4-[(2-chloroacetyl)amino]-3,5-dimethyl-1H-pyrrol-2-yl]methylidene]-N-[(1R)-1-(4-fluorophenyl)ethyl]-2-oxo-1H-indole-5-carboxamide |
| InChI | InChI=1S/C26H24ClFN4O3/c1-13-22(29-15(3)24(13)32-23(33)12-27)11-20-19-10-17(6-9-21(19)31-26(20)35)25(34)30-14(2)16-4-7-18(28)8-5-16/h4-11,14,29H,12H2,1-3H3,(H,30,34)(H,31,35)(H,32,33)/b20-11-/t14-/m1/s1 |
| InChIKey | IDWBLFLYQVHAFH-LPKQHDGYSA-N |
| SMILES | CC1=C(NC(=C1NC(=O)CCl)C)/C=C\2/C3=C(C=CC(=C3)C(=O)N[C@H](C)C4=CC=C(C=C4)F)NC2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
