For research use only. Not for therapeutic Use.
CCPA（Cat No.:R052278）is (4-(3-Chlorophenyl)-2-(3,4-dimethoxyphenyl)-5,6-dihydro-1H-pyrrolo[3,4-b]quinolin-1-one). This compound is of interest in scientific research due to its potential biological activities, such as its use in medicinal chemistry for developing novel therapeutic agents. CCPA is often studied in the context of drug discovery, particularly for its possible applications in oncology or neurobiology. Researchers explore its molecular properties and interactions to determine its effectiveness and safety in various therapeutic settings.
| CAS Number | 37739-05-2 |
| Synonyms | (2R,4R,5R)-2-[2-chloro-6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| Molecular Formula | C15H20ClN5O4 |
| Purity | ≥95% |
| IUPAC Name | (2R,3R,4S,5R)-2-[2-chloro-6-(cyclopentylamino)purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChI | InChI=1S/C15H20ClN5O4/c16-15-19-12(18-7-3-1-2-4-7)9-13(20-15)21(6-17-9)14-11(24)10(23)8(5-22)25-14/h6-8,10-11,14,22-24H,1-5H2,(H,18,19,20)/t8-,10-,11-,14-/m1/s1 |
| InChIKey | XSMYYYQVWPZWIZ-IDTAVKCVSA-N |
| SMILES | C1CCC(C1)NC2=C3C(=NC(=N2)Cl)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
