For research use only. Not for therapeutic Use.
CCR8 Antagonist 2（Cat No.:I043896）is a selective compound that targets the CCR8 receptor, a chemokine receptor involved in immune cell trafficking, inflammation, and the recruitment of T-cells to sites of inflammation. By inhibiting CCR8, this antagonist prevents the migration of immune cells involved in chronic inflammatory conditions and autoimmune diseases. It shows promise for the treatment of diseases like multiple sclerosis, inflammatory bowel disease, and cancer, where CCR8-mediated immune responses contribute to disease progression. CCR8 Antagonist 2 offers a potential therapeutic approach to modulate immune function and reduce inflammation.
| CAS Number | 2756350-98-6 |
| Synonyms | N-[2-chloro-6-methyl-4-[[(1R)-1-(1-methylpiperidin-4-yl)ethyl]sulfamoyl]phenyl]-2-methylbenzamide |
| Molecular Formula | C23H30ClN3O3S |
| Purity | ≥95% |
| IUPAC Name | N-[2-chloro-6-methyl-4-[[(1R)-1-(1-methylpiperidin-4-yl)ethyl]sulfamoyl]phenyl]-2-methylbenzamide |
| InChI | InChI=1S/C23H30ClN3O3S/c1-15-7-5-6-8-20(15)23(28)25-22-16(2)13-19(14-21(22)24)31(29,30)26-17(3)18-9-11-27(4)12-10-18/h5-8,13-14,17-18,26H,9-12H2,1-4H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | ZEDJVOTUUKLHRW-QGZVFWFLSA-N |
| SMILES | CC1=CC=CC=C1C(=O)NC2=C(C=C(C=C2C)S(=O)(=O)N[C@H](C)C3CCN(CC3)C)Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
