For research use only. Not for therapeutic Use.
CCT245232 is a potent inhibitor of heat shock factor 1 (HSF1). HSF1 is the master regulator of the heat shock response, in which multiple genes are induced in response to temperature increase and other stresses. CCT245232 has the potential for the research of proliferative diseases, such as cancer (extracted from patent WO2015049535A1)[1].
| Catalog Number | I044037 |
| CAS Number | 1693731-14-4 |
| Synonyms | N-[5-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)-2-methylphenyl]-2-methylquinoline-6-carboxamide |
| Molecular Formula | C27H23N3O4 |
| Purity | ≥95% |
| InChI | InChI=1S/C27H23N3O4/c1-16-3-8-21(29-26(31)20-7-10-24-25(14-20)34-12-11-33-24)15-23(16)30-27(32)19-6-9-22-18(13-19)5-4-17(2)28-22/h3-10,13-15H,11-12H2,1-2H3,(H,29,31)(H,30,32) |
| InChIKey | RZQWMJAOUJLEAM-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NC(=O)C2=CC3=C(C=C2)OCCO3)NC(=O)C4=CC5=C(C=C4)N=C(C=C5)C |
| Reference | [1]. Keith Jones, et al. Fused 1,4-dihydrodioxin derivatives as inhibitors of heat shock transcription factor 1. Patent WO2015049535A1. |
